On Target ESR1_HUMAN 0.3271028/CHEMBL2071175
For the given ligand Aceclofenac, we have found in our database that, being scored 0.3271028, the most similar ligand is CHEMBL2071175. Check out the elaboration below.
| Aceclofenac (Given Ligand) | CHEMBL2071175 (Similar Ligand) |
|---|---|
| O=C(O)COC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl | Oc1ccc(cc1)C(=O)OCCc2ccccc2 |
|
|
|
|
|
|
| 00008002 00000000 00000500 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 6000d800 03008004 00000400 40060040 08088008 08068000 82000000 0c000002 00000000 40010420 48000b00 25000000 08400014 00002400 80000600 02000008 000010a0 00008208 00261002 00002000 22020400 | 00000000 00000808 20000101 00010200 00000050 00004000 02000000 00000040 00000100 00080840 08000000 40008000 00008002 00010000 00040000 02080008 08020000 02000000 04000000 00020000 00010020 08020a20 01000000 00400014 00000400 80002000 004a0000 00000000 00000200 00020002 c0000000 02000400 |