On Target MIF_HUMAN 0.34313726/CHEMBL223319
For the given ligand Alclofenac, we have found in our database that, being scored 0.34313726, the most similar ligand is CHEMBL223319. Check out the elaboration below.
| Alclofenac (Given Ligand) | CHEMBL223319 (Similar Ligand) |
|---|---|
| C=CCOc1ccc(CC(=O)O)cc1Cl | COc1ccc(N\N=C\c2ccc(O)c(Cl)c2)cc1 |
|
|
|
|
|
|
| 04008000 04000028 20000108 00410200 00001040 00000000 06040000 00000400 00000000 00080840 08000000 40009800 03808006 00000000 c1040009 00080008 08000000 02000000 00000010 00020001 00000000 08000b00 01000000 00500010 00002000 80008800 00120000 00000000 00000200 00020002 04002000 00020410 | 0000a00a 00000008 20000108 00030200 00001000 04000000 06000000 01004008 00000100 00000841 00000004 40008800 82000046 00000000 81010041 00084008 04000000 02000000 00000400 00220000 40080000 0c000100 70040802 00600000 00002000 80000800 40060000 00000000 00000208 000e0400 40000000 00020000 |