On Target HRH1_HUMAN 0.4774775/CHEMBL2158820
For the given ligand Alclofenac, we have found in our database that, being scored 0.4774775, the most similar ligand is CHEMBL2158820. Check out the elaboration below.
| Alclofenac (Given Ligand) | CHEMBL2158820 (Similar Ligand) |
|---|---|
| C=CCOc1ccc(CC(=O)O)cc1Cl | OC(=O)[C@@H](N1CCC(CN2CCC(CC2)Oc3ccc(Cl)c(Cl)c3)CC1)c4ccccc4 |
|
|
|
|
|
|
| 04008000 04000028 20000108 00410200 00001040 00000000 06040000 00000400 00000000 00080840 08000000 40009800 03808006 00000000 c1040009 00080008 08000000 02000000 00000010 00020001 00000000 08000b00 01000000 00500010 00002000 80008800 00120000 00000000 00000200 00020002 04002000 00020410 | 04008000 01000008 20100108 00010600 000010c0 02000000 92000000 22001000 00200000 000808c0 08200000 5003b800 03808806 00000002 c10c0403 00082008 18200000 02000400 00800000 00020201 00000000 18008b00 03000080 00500010 00002001 c0100000 00100000 90000000 00000300 00060002 20046000 00022640 |