On Target IKKB_HUMAN 0.30113637/CHEMBL3823943
For the given ligand Aceclofenac, we have found in our database that, being scored 0.30113637, the most similar ligand is CHEMBL3823943. Check out the elaboration below.
| Aceclofenac (Given Ligand) | CHEMBL3823943 (Similar Ligand) |
|---|---|
| O=C(O)COC(=O)Cc1ccccc1Nc2c(Cl)cccc2Cl | C=C1CC2(OC1=O)C(=O)Nc3ccccc23 |
|
|
|
|
|
|
| 00008002 00000000 00000500 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 6000d800 03008004 00000400 40060040 08088008 08068000 82000000 0c000002 00000000 40010420 48000b00 25000000 08400014 00002400 80000600 02000008 000010a0 00008208 00261002 00002000 22020400 | 00054002 01000000 00101312 80010600 20080090 00006000 03000000 00000400 11000900 001a08c2 083c00a4 4001d080 05008030 01310000 400a114c 0a080008 0006c000 82000000 08400018 00008001 40100120 18200e20 33002000 81d00115 50000400 80002200 08082010 900010a0 04008200 80060403 44002080 22410610 |