On Target NMDZ1_HUMAN 0.18686868/CHEMBL399075
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.18686868, the most similar ligand is CHEMBL399075. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL399075 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | CS(=O)(=O)N(CC1CCCCO1)c2c(Cl)c(Cl)cc3NC(=O)C(=O)Nc23 |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 0001c022 01008004 00101006 81310720 a00c00c0 08002010 08008026 08401000 06040000 004008e0 0c242004 40018800 02108c0c 00c00001 80de1049 000e104c 0c040000 28000400 08602000 09004001 401400a1 18048910 33800000 50310850 920064a2 40100400 18008480 100200ac 04008200 00460000 00040000 004322f0 |