Created at: Last updated at: Current status:
|
Name | Aspirin |
2D and 3D depictions |
|
SMILES | CC(=O)Oc1ccccc1C(=O)O |
Model downloads | |
Fingerprints |
Name | Mesalazine |
2D and 3D depictions |
|
SMILES | Nc1ccc(O)c(C(=O)O)c1 |
Model downloads | |
Fingerprints |
Name | Sulfasalazine |
2D and 3D depictions |
|
SMILES | O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O |
Model downloads | |
Fingerprints |
Name | Methotrimeprazine |
2D and 3D depictions |
|
SMILES | COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 |
Model downloads | |
Fingerprints |
Name | Ketamine |
2D and 3D depictions |
|
SMILES | CNC2(c1ccccc1Cl)CCCCC2=O |
Model downloads | |
Fingerprints |