On Target NMDZ1_HUMAN 0.2635659/CHEMBL163916
For the given ligand Mesalazine, we have found in our database that, being scored 0.2635659, the most similar ligand is CHEMBL163916. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL163916 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | OC(=O)c1[nH]c2cc(Cl)cc(Cl)c2c1CNC(=O)c3ccccc3 |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 10018002 09800800 00000100 10010610 000c1020 0000c020 04004080 0a001000 00000300 00080848 01280004 40008800 0200888e 00708400 800204c0 020c000c 0002a008 0280000c 00200000 00000000 c0020000 08068fe8 20802002 8040000c 00046000 c0000400 08044000 80000000 00000104 00060001 c0048200 80420220 |