On Target PERM_HUMAN 0.31496063/CHEMBL490
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.31496063, the most similar ligand is CHEMBL490. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL490 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | Fc1ccc(cc1)[C@@H]2CCNC[C@H]2COc3ccc4OCOc4c3 |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 04000001 01000208 20100108 02010700 00081000 02000010 42000000 20000000 00200800 000808c0 48300000 50018000 00804002 01001000 11000001 002ca008 00a00000 02000084 00c80000 00120a01 00040300 18000000 010000c0 00500010 40000001 80000000 00080000 30000001 01050200 0006800a 00000000 02012640 |