On Target PERM_HUMAN 0.49253732/CHEMBL686
For the given ligand Mesalazine, we have found in our database that, being scored 0.49253732, the most similar ligand is CHEMBL686. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL686 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | Cc1cccc(Nc2ccccc2C(=O)O)c1C |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 00000002 00000800 00000100 00010200 00000000 00014000 00000010 00000040 00802100 00400850 00200004 40009000 04008000 00200000 00020040 00080008 00040000 02000000 0800800a 00000000 41000000 08020a20 20000000 00400004 00040000 80000000 02000000 00001080 00408000 00260000 c0000000 00000000 |