On Target PDE5A_HUMAN 0.2451613/CHEMBL8132
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.2451613, the most similar ligand is CHEMBL8132. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL8132 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | CCn1ncc2c(N[C@@H](C)C3CCCCC3)c4cc(ccc4nc12)C#N |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 00004006 01000c08 60104100 08090600 200c0020 00006004 02008000 00200800 00000100 008008c0 0020000c 41018000 00001827 00c08000 000200c0 000c000c 00448000 02800004 0ae02000 00220001 c0100000 1c058038 21800c47 82700010 00002401 80000000 00058400 10000880 00408000 00060400 400e0000 00000260 |