On Target PDE5A_HUMAN 0.3272727/CHEMBL116818
For the given ligand Mesalazine, we have found in our database that, being scored 0.3272727, the most similar ligand is CHEMBL116818. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL116818 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | COC(=O)c1cccc(Nc2nc(nc3ccccc23)c4ccccc4)c1 |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 00000002 00000800 80000100 18090600 01040020 00004000 00009010 00080800 10002100 10000850 01300004 40009800 04008000 00510000 00020040 120c000c 00060000 12006000 0861000a 90600000 41000000 08062a28 20804040 00400004 00040000 80002000 02000000 000000a0 2042820c 00460400 c0000800 000000c2 |