On Target COMT_HUMAN 0.27941176/CHEMBL3425731
For the given ligand Ketamine, we have found in our database that, being scored 0.27941176, the most similar ligand is CHEMBL3425731. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL3425731 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | CCCCc1ccc(cc1)N2C=C(O)C(=O)C=C2CO |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 00000002 01000a08 60004102 50010600 00040028 00004004 04800000 00201000 02100b00 800808c0 08100004 40018000 80008804 00600200 00020040 020c000c 00008000 02804004 00200000 00060001 40000100 18008030 20800002 81500014 02002400 c0000040 00420060 00040000 04000004 0806000a c0040000 40200400 |