On Target TRPV1_RAT 0.2868217/CHEMBL101775
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.2868217, the most similar ligand is CHEMBL101775. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL101775 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | COc1cc(CC(=O)NCC(CCc2ccccc2)COC(=O)C(C)(C)C)ccc1O |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 00000040 43001008 2010010a 00010700 00081000 80000000 02000000 20000000 00100880 000808c0 08300000 40019000 0100c002 20280000 41000001 00089008 00a20000 02000000 00c80000 00020201 00000120 18340e00 01000080 81500018 00000401 80000000 00120000 10010000 04000200 00060007 00002000 00002600 |