On Target TRPV1_RAT 0.3715847/CHEMBL214880
For the given ligand Sulfasalazine, we have found in our database that, being scored 0.3715847, the most similar ligand is CHEMBL214880. Check out the elaboration below.
| Sulfasalazine (Given Ligand) | CHEMBL214880 (Similar Ligand) |
|---|---|
| O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O | CC(C)(C)c1ccc(NC(=O)c2ccc(cc2)c3ncccc3NS(=O)(=O)c4ccccc4)cc1 |
|
|
|
|
|
|
| 00000012 00882808 61004102 00b10200 00050012 00024000 02000000 00000800 00000300 00040840 00002104 60008000 00048c02 08000001 80280050 102e200c 0000a000 02800000 00600000 80226001 c0000000 0e229a20 20840846 0860200c 00050480 c1000000 80040080 0400004c 00500408 20060000 c0000080 00010060 | 00006012 00800804 01004906 50b10620 00040020 00000000 00000000 02481000 00010100 100808c0 0828a004 6000c000 80048c00 80108021 802a0040 02060004 00062000 02002408 0c600000 10406000 c0180000 08028e00 30852040 0840001c 00000080 80000000 00000040 800000cc 0000c504 20460403 80040800 000106e0 |