On Target TRPV1_RAT 0.5857143/CHEMBL1779679
For the given ligand Mesalazine, we have found in our database that, being scored 0.5857143, the most similar ligand is CHEMBL1779679. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL1779679 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | OC(=O)c1cccc(NC(=O)Nc2cccc3ccc(O)cc23)c1 |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 00000006 00000808 20000100 00010a40 04000000 00004000 02000000 00002001 00000100 00000850 00280004 40008000 00008022 08100000 00000040 10080008 00040000 02000000 08000000 80020000 40000100 08020e28 20022000 00400004 00140000 80000000 00040000 00000080 20428000 00060001 c0000000 00004000 |