On Target TRPV1_RAT 0.44/CHEMBL2057845
For the given ligand Ketamine, we have found in our database that, being scored 0.44, the most similar ligand is CHEMBL2057845. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL2057845 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | CC(C)(C)c1ccc(CNC(=O)Cc2ccc(O)c(Cl)c2)cc1 |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 00008000 04800008 20100100 00010600 00000000 00000000 06000000 02001000 00000180 00080840 08200000 40009800 83008806 00000000 c0000400 00000008 00000000 02000000 00000000 00020201 80000000 18208700 00000000 81480018 00002000 c0000800 00120000 80000000 04000100 00060003 20042000 00020600 |