On Target FABP5_HUMAN 0.1534091/CHEMBL3941588
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.1534091, the most similar ligand is CHEMBL3941588. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL3941588 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | OC(=O)c1c(nc2ccc(Cl)cc2c1c3ccccc3)N4CCCCC4 |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 1801e002 01800801 40104100 00010610 20041004 0001e040 04000000 00100000 00c00100 200008d0 00200004 70019800 8700880e 00600000 20020040 000c000e 00060000 02004004 0c200000 00a00201 c0100000 1c068b68 30800800 8070001c 00042000 80080000 08040280 100010c0 0040c008 00060800 c0041000 01020220 |