On Target FABP5_HUMAN 0.27044025/CHEMBL3941588
For the given ligand Ketamine, we have found in our database that, being scored 0.27044025, the most similar ligand is CHEMBL3941588. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL3941588 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | OC(=O)c1c(nc2ccc(Cl)cc2c1c3ccccc3)N4CCCCC4 |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 1801e002 01800801 40104100 00010610 20041004 0001e040 04000000 00100000 00c00100 200008d0 00200004 70019800 8700880e 00600000 20020040 000c000e 00060000 02004004 0c200000 00a00201 c0100000 1c068b68 30800800 8070001c 00042000 80080000 08040280 100010c0 0040c008 00060800 c0041000 01020220 |