On Target PAR1_HUMAN 0.33027524/CHEMBL97706
For the given ligand Mesalazine, we have found in our database that, being scored 0.33027524, the most similar ligand is CHEMBL97706. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL97706 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | CN1C(=N)N(CC(=O)c2cc(c(O)c(c2)C(C)(C)C)C(C)(C)C)c3ccccc13 |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 0000000a 00000a08 28000101 00010700 000c10c1 00004000 02000000 00000200 00100300 00080ac0 0900800c 4001a000 00009002 00c00000 000000c0 0c0c200c 10808000 42800000 00600000 00020000 c0000000 18020230 23800007 81400016 00000000 80008000 41120000 00800000 04000000 0046000a c0080000 00000480 |