On Target PAR1_HUMAN 0.43137255/CHEMBL3658406
For the given ligand Ketamine, we have found in our database that, being scored 0.43137255, the most similar ligand is CHEMBL3658406. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL3658406 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | CCc1ccc(cc1)C2CC(CN(C2)C(=O)C3CCCC3)NC(=O)C(C)(C)C |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 00010000 01003200 00100102 04010600 00000000 00000000 00000000 2000000c 00300980 000808c0 08300000 50039800 0400800a 00202000 00000000 00040000 00000000 02000000 00002000 00000201 00000100 38240610 00000001 83500018 00000000 80000000 00000000 10000000 0c000000 0106000b 00000000 00002600 |