On Target SC6A4_HUMAN 0.40625/CHEMBL1172744
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.40625, the most similar ligand is CHEMBL1172744. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL1172744 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | COC[C@@]12CNCC[C@@]1(C2)c3ccc4ccccc4c3 |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 00000000 01000208 00100102 00010700 00080000 00000000 00000000 20000000 00100800 000808c0 08300000 50018000 00000002 01a00000 00000000 000c0008 00a00000 02000000 00c02000 80000201 00000100 18000018 010000c0 00500010 00000001 80000000 00000000 10000000 00000200 0006000a 00000000 00002600 |