On Target SC6A4_HUMAN 0.35064936/CHEMBL204199
For the given ligand Mesalazine, we have found in our database that, being scored 0.35064936, the most similar ligand is CHEMBL204199. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL204199 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | CN(C)Cc1ccccc1Oc2ccc(C)cc2N |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 00000002 00000028 20000108 00010600 80001000 00000100 02040000 02401400 00000004 00000840 08200004 40008000 00000802 00000000 01000041 00006008 00000000 02000000 00002000 00020000 41400000 08008000 20000000 00400000 00040000 80000000 00020000 80200000 00400320 00060000 04060400 00000200 |