On Target SC6A4_HUMAN 0.63095236/CHEMBL2407327
For the given ligand Ketamine, we have found in our database that, being scored 0.63095236, the most similar ligand is CHEMBL2407327. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL2407327 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | Cl.CCCC(=O)C(C1CCNCC1)c2ccc(Cl)c(Cl)c2 |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 00018000 05000000 00100102 00010600 00000000 00000000 04000000 20000000 00100800 000808c0 08300000 50019800 07008036 00200000 c0000000 00000000 00000000 02000000 00002000 00000201 00000100 18000310 00000000 00540010 00002000 80100000 00040000 10000000 00000002 00060002 00022000 00020600 |