On Target MK01_HUMAN 0.39869282/CHEMBL3590110
For the given ligand Sulfasalazine, we have found in our database that, being scored 0.39869282, the most similar ligand is CHEMBL3590110. Check out the elaboration below.
| Sulfasalazine (Given Ligand) | CHEMBL3590110 (Similar Ligand) |
|---|---|
| O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O | C=CS(=O)(=O)Nc1ccc2[nH]nc(c3ccncc3)c2c1 |
|
|
|
|
|
|
| 00000012 00882808 61004102 00b10200 00050012 00024000 02000000 00000800 00000300 00040840 00002104 60008000 00048c02 08000001 80280050 102e200c 0000a000 02800000 00600000 80226001 c0000000 0e229a20 20840846 0860200c 00050480 c1000000 80040080 0400004c 00500408 20060000 c0000080 00010060 | 00002802 00000808 a0004102 40310200 01040000 00000002 02400000 00400400 00000000 000008c0 40002004 60008000 80000c12 00400001 80080040 000e200c 00220000 02000008 04600000 00224400 40000000 0c028808 34800800 00604008 00100080 80000000 10020000 0000006c 00004004 00060200 00000400 00014060 |