On Target HYES_HUMAN 0.5319149/CHEMBL1933676
For the given ligand Ketamine, we have found in our database that, being scored 0.5319149, the most similar ligand is CHEMBL1933676. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL1933676 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | Clc1ccccc1C(=O)N2CCC(CC2)C(=O)NC3CCCCCC3 |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 00028000 01001800 00100100 00010600 00000000 00000000 00000000 22001000 00200000 000008c0 00200000 50039800 06008806 00000000 00000400 00000000 00000000 03000000 00002000 00000201 00000800 18068710 00000000 0050001c 00002000 c0000200 00000000 90001100 00000100 00060001 a8060000 00822200 |