On Target TRPV3_HUMAN 0.27586207/CHEMBL3692265
For the given ligand Sulfasalazine, we have found in our database that, being scored 0.27586207, the most similar ligand is CHEMBL3692265. Check out the elaboration below.
| Sulfasalazine (Given Ligand) | CHEMBL3692265 (Similar Ligand) |
|---|---|
| O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O | CCN(CC)S(=O)(=O)c1cccc(c1)c2ccc(F)c(CN[C@@H](CO)C(C)C)n2 |
|
|
|
|
|
|
| 00000012 00882808 61004102 00b10200 00050012 00024000 02000000 00000800 00000300 00040840 00002104 60008000 00048c02 08000001 80280050 102e200c 0000a000 02800000 00600000 80226001 c0000000 0e229a20 20840846 0860200c 00050480 c1000000 80040080 0400004c 00500408 20060000 c0000080 00010060 | 0000209a 00800000 01104100 17b10e00 008c01a1 00190022 00400000 02083041 00000000 10020840 00212004 60008010 00000802 00001001 80220480 020c010d 12022200 02002022 04600000 00506201 c0000003 18018000 33800000 28400018 02100000 c0000004 00000c40 8000104d 00004504 20260402 21040800 20014260 |