On Target AMPN_HUMAN 0.20652173/CHEMBL3805817
For the given ligand Mesalazine, we have found in our database that, being scored 0.20652173, the most similar ligand is CHEMBL3805817. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL3805817 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | COc1ccc(CNCC(N)P(=O)(O)O)cc1 |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 00000400 00000608 20000108 00010620 00005000 00000000 02040000 02001000 00000000 00010840 00200000 40008000 00000802 00020000 01000401 00000008 00000028 02000000 00000000 00020000 00000000 2d308000 00800000 02400000 00002002 c0000000 00220000 80014000 08080300 00060000 20840000 00008223 |