On Target AOFA_HUMAN 0.41975307/CHEMBL3330339
For the given ligand Ketamine, we have found in our database that, being scored 0.41975307, the most similar ligand is CHEMBL3330339. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL3330339 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | C[C@]1(N)C[C@@H]1c2ccccc2.OC(=O)C(F)(F)F |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 00000000 01000200 00100102 00010600 00000000 00000000 00000000 00000000 00000800 000808c0 08100000 40008000 00008000 01200000 00000000 00080008 00000000 02000000 00000000 00000005 00000100 18000a00 00000000 81400010 00000000 80000000 00000000 90000000 04000000 0006000a 00000000 00000600 |