On Target ADRB2_HUMAN 0.31343284/CHEMBL1083363
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.31343284, the most similar ligand is CHEMBL1083363. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL1083363 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | OC(COc1cccc2[nH]c3ccccc3c12)CN4CCC(CC4)N5C(=O)c6cccc7cccc(C5=O)c67 |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 04000002 01000408 20104108 02010600 00041080 020000e0 06080000 20000008 06200000 c00009e0 04200004 50018000 00808806 00640000 01380041 000c200c 10300000 00000004 00a00000 00060201 40000000 18008018 27800080 88300010 00002001 40000000 00000000 10800000 00000200 00060010 00040200 00202240 |