On Target ADRB2_HUMAN 0.53846157/CHEMBL1557985
For the given ligand Sulfasalazine, we have found in our database that, being scored 0.53846157, the most similar ligand is CHEMBL1557985. Check out the elaboration below.
| Sulfasalazine (Given Ligand) | CHEMBL1557985 (Similar Ligand) |
|---|---|
| O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O | CCc1ccccc1N(C)S(=O)(=O)c2ccc3ncc(C(=O)O)c(O)c3c2 |
|
|
|
|
|
|
| 00000012 00882808 61004102 00b10200 00050012 00024000 02000000 00000800 00000300 00040840 00002104 60008000 00048c02 08000001 80280050 102e200c 0000a000 02800000 00600000 80226001 c0000000 0e229a20 20840846 0860200c 00050480 c1000000 80040080 0400004c 00500408 20060000 c0000080 00010060 | 00000012 00804808 21004902 00b10210 00041000 00024000 02000000 00000800 00000100 00080840 08202004 60008000 00048c02 80400001 806a00c0 000e200c 0006a000 02000004 08600800 00066801 c0000000 08868a68 20840040 8840001c 00040080 80000100 08000000 0000108c 00408400 20060002 c0040000 20210460 |