On Target ADRB2_HUMAN 0.4848485/CHEMBL1524289
For the given ligand Ketamine, we have found in our database that, being scored 0.4848485, the most similar ligand is CHEMBL1524289. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL1524289 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | Oc1ccc(CC2(CCCCC2)NC(=O)c3ccccc3)cc1 |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 00000000 01001808 20100102 00010600 00000000 00000000 02000000 22001004 00000880 000808c0 08300000 40018000 00008802 00200000 00000400 00000008 00000000 02000000 02002000 00020201 00000100 18268610 00000000 8150001c 00000000 c0000000 00120000 90000000 04000102 00060003 a0060000 00000600 |