On Target GLRA3_HUMAN 0.15929204/CHEMBL4070615
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.15929204, the most similar ligand is CHEMBL4070615. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL4070615 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | C[C@H]1[C@@H]2[C@H](CN1S(=O)(=O)c3ccc4OCOc4c3)c5cnccc5N(C)C2=O |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 00020052 23804608 2110410a 01b00610 200c1700 00042050 0301a000 20040000 00600880 004909e0 40382034 60039000 0c00c803 10300801 81e20201 0024800e 000ce004 02000004 00680c18 00027e03 e0140300 18248600 20804000 99410018 42041800 0108000c 08828010 3000108c 05480600 20060a1b 00000080 20812670 |