On Target PPARG_HUMAN 0.2969697/CHEMBL377213
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.2969697, the most similar ligand is CHEMBL377213. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL377213 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | [Na+].CN(CCOc1ccc(CC2SC(=O)NC2=O)cc1)C(=O)CCCCC(S)CCSC(=O)CCC(=O)[O-] |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 04052000 01005308 20114308 00110686 00011080 02002800 02040000 20000000 84600800 030948c1 08300001 400b9300 0481a00a 000c0000 01081001 000c0008 14000410 02000200 00402008 00020301 40020108 18040e14 13040300 02700018 00000800 80000020 00920000 14000041 00000202 0006007b 00024010 83010e00 |