On Target PPARG_HUMAN 0.42307693/CHEMBL3765141
For the given ligand Ketamine, we have found in our database that, being scored 0.42307693, the most similar ligand is CHEMBL3765141. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL3765141 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | CCC(Cc1ccc(cc1)C(=O)NCc2ccccc2C(F)(F)F)C(=O)O |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 00000000 01800800 00100102 50010600 00000000 00000000 00000400 02001000 00000900 00080850 08300000 40009800 84008802 01200000 00000480 00080008 00002000 02000000 00402008 00000001 84020100 08028e00 01000040 0040001c 00000800 c0000000 00004000 90000000 00000100 00060003 80160000 00000600 |