On Target CASP1_HUMAN 0.34615386/CHEMBL422849
For the given ligand Sulfasalazine, we have found in our database that, being scored 0.34615386, the most similar ligand is CHEMBL422849. Check out the elaboration below.
| Sulfasalazine (Given Ligand) | CHEMBL422849 (Similar Ligand) |
|---|---|
| O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O | OC(=O)C[C@H](NC(=O)c1ccc(CNS(=O)(=O)c2ccc(O)c(c2)C(=O)O)cc1)C=O |
|
|
|
|
|
|
| 00000012 00882808 61004102 00b10200 00050012 00024000 02000000 00000800 00000300 00040840 00002104 60008000 00048c02 08000001 80280050 102e200c 0000a000 02800000 00600000 80226001 c0000000 0e229a20 20840846 0860200c 00050480 c1000000 80040080 0400004c 00500408 20060000 c0000080 00010060 | 00048010 00805809 21188100 41b10600 00080120 00034000 06000001 02001800 02000100 00001840 00302000 6000b000 8e008802 00000001 80200480 00082108 00002000 02100001 00c00810 00026201 80000000 18128e20 01000080 0840001c 02001001 c0000004 40000000 8000108c 00000502 20060001 e0044000 40010360 |