On Target CHLE_HUMAN 0.32692307/CHEMBL577112
For the given ligand Mesalazine, we have found in our database that, being scored 0.32692307, the most similar ligand is CHEMBL577112. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL577112 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | CN(C)C(=O)O[C@H]1CO[C@@H]2[C@@H](CO[C@H]12)OC(=O)c3ccccc3O |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 00000040 01400809 a0000508 00010300 002800d0 00024000 02000000 80000840 00002300 01000840 00200000 40008010 00008002 02810100 00080000 021ab008 00820800 02000000 11402800 00020001 00000020 38020e30 05000000 08400014 00000400 80003002 00080000 00000060 00000200 0006000b c0000000 02000000 |