On Target PDE4B_HUMAN 0.2536232/CHEMBL35486
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.2536232, the most similar ligand is CHEMBL35486. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL35486 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | COC(=O)CC(=O)N1CCC(C1)c2ccc(OC)c(OC3CCCC3)c2 |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 04000000 43001208 20100108 00210700 00081000 c2200010 02040000 20000004 00000980 000808c0 08300000 40009000 1880c002 20000080 11000001 020ca008 00a20000 02000000 00c80010 00020201 00000100 18240e00 01000080 81400018 00001001 80000000 00120000 10000000 04000200 0106000b 00000000 00002640 |