On Target PDE4B_HUMAN 0.32673267/CHEMBL3315270
For the given ligand Mesalazine, we have found in our database that, being scored 0.32673267, the most similar ligand is CHEMBL3315270. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL3315270 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | CCc1nc(Nc2ccc(cc2)C(=O)O)nc(n1)c3cccc(Cl)c3 |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 00008002 00000800 80000100 80090200 05000000 00004000 04000000 00080840 00000100 00040840 00208004 40009800 06008004 00108000 80020040 1808000c 00048800 12006000 08000008 10204000 40000000 08422b20 60006000 00400014 00002000 81000200 00000008 000010a0 0000800c 00660000 c0000800 20020002 |