On Target ACM4_HUMAN 0.39130434/CHEMBL2146598
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.39130434, the most similar ligand is CHEMBL2146598. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL2146598 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | O=C1Nc2ccccc2N1C3CCN(CC3)C4CCOCC4 |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 00000002 01000400 00100100 00010700 800c0040 00004080 00000000 20000000 04200100 800009e0 0d20800c 50018000 00009002 01cc0000 003000c0 000c000c 00300000 00000000 00e00000 00000201 c0000020 18000030 21800081 00300010 00000401 40000000 00000000 10000000 00000200 00460010 40080000 00002280 |