On Target ACM4_HUMAN 0.5102041/CHEMBL809
For the given ligand Ketamine, we have found in our database that, being scored 0.5102041, the most similar ligand is CHEMBL809. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL809 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | CN[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c3ccccc13 |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 00008008 05000000 00100102 10010600 00000000 00000002 04000400 03001001 00100800 000808c4 08300000 40018800 020008a4 00200000 80000000 00000080 00000200 02000000 00102000 00000001 00020100 18008100 00004000 00540010 00002000 a0100001 00040000 d0000000 02000182 00860002 00040000 00020600 |