On Target BACE1_HUMAN 0.41333333/CHEMBL1917912
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.41333333, the most similar ligand is CHEMBL1917912. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL1917912 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | CCCS[C@H]1CN[C@H](C1)[C@@H](O)[C@H](Cc2cc(F)cc(F)c2)NC(=O)[C@H](CCc3ccccc3)N4CC[C@](NC(=O)C)(C(C)CC)C4=O |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 00030000 43007600 20100102 0e110640 00080080 00002010 00000000 2000000c 04700880 020b69e0 08300000 d00fb000 06018006 01243001 80180000 000c0008 14000000 02000000 00402000 00000201 40000100 382c0610 03000343 87700018 00000000 80000000 80004000 10000001 0c300002 0006803b 20024000 03c12600 |