On Target BACE1_HUMAN 0.36633664/CHEMBL1210351
For the given ligand Sulfasalazine, we have found in our database that, being scored 0.36633664, the most similar ligand is CHEMBL1210351. Check out the elaboration below.
| Sulfasalazine (Given Ligand) | CHEMBL1210351 (Similar Ligand) |
|---|---|
| O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O | CS(=O)(=O)N(c1cccc(c1)C(=O)N[C@@H](Cc2ccccc2)[C@H](O)CNCc3cccc(c3)C(F)(F)F)c4ccccn4 |
|
|
|
|
|
|
| 00000012 00882808 61004102 00b10200 00050012 00024000 02000000 00000800 00000300 00040840 00002104 60008000 00048c02 08000001 80280050 102e200c 0000a000 02800000 00600000 80226001 c0000000 0e229a20 20840846 0860200c 00050480 c1000000 80040080 0400004c 00500408 20060000 c0000080 00010060 | 1000000a 010a5c00 00104102 00310600 00040081 08000000 10000410 22001004 00902980 000809f0 08302004 40018802 00008c02 01200001 80081440 100e000c 10040000 12004000 08600002 10a04201 41000100 1e2a9e00 23800844 8170001c 00040080 c0000000 0a008080 9401008c 2440810a 00060817 e0140000 00010660 |