On Target BACE1_HUMAN 0.496063/CHEMBL2011990
For the given ligand Ketamine, we have found in our database that, being scored 0.496063, the most similar ligand is CHEMBL2011990. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL2011990 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | CN1C(=N)NC(C2CCCC2)(C1=O)c3cccc(c3)c4cccc(Cl)c4 |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 0001a000 01000000 00100102 00810e00 00001001 04000000 14000004 02003000 00000e40 000808d2 09300000 4001b800 0700980c 00202000 c0000000 00180008 0003c008 02003000 04002000 00002001 00010100 38218710 11000000 81500010 00012000 80000080 48000000 90004041 0c004112 01060003 800e6000 80020600 |