On Target NEP_HUMAN 0.2735849/CHEMBL273672
For the given ligand Mesalazine, we have found in our database that, being scored 0.2735849, the most similar ligand is CHEMBL273672. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL273672 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | CC(C(CS)C(=O)NC(Cc1ccc(O)cc1)C(=O)O)c2ccc(N)cc2 |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 00000002 00005a08 20100100 40110600 00000080 00000000 02000000 20000004 00000880 000808c0 08300004 4000b000 06008002 00040000 80080040 000c0008 10000000 02000000 00400008 00420201 60000100 18200e00 23000340 81400018 00000800 80000000 00120000 10000000 04000000 0006003b 20004000 01012600 |