On Target NEP_HUMAN 0.4787234/CHEMBL378050
For the given ligand Ketamine, we have found in our database that, being scored 0.4787234, the most similar ligand is CHEMBL378050. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL378050 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | CCCC(CC1(CCCC1)C(=O)N[C@H](C)c2ccccc2)C(=O)O |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 00010000 01800000 00100100 00010600 00080000 00000000 00000000 22001000 00000000 000a08c0 08200000 40019000 0400883a 01800000 00000400 00080008 00000000 02000000 00402000 00000201 80000000 18008e10 01000000 00500018 00000000 c0000000 00000000 90000000 00000100 01060003 20060000 00000600 |