On Target HPGDS_HUMAN 0.2638889/CHEMBL3650224
For the given ligand Ketamine, we have found in our database that, being scored 0.2638889, the most similar ligand is CHEMBL3650224. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL3650224 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | O=C(Nc1ccc(cc1)N2CCC(CC2)C(=O)N3CCOCC3)N4CCN(CC4)C(=O)c5ccccc5 |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 00024006 01007800 00100100 84010e00 20000080 00002000 00000004 22003009 00200000 000308c0 00280004 50039000 0400a802 00102000 000a1448 00080108 10040010 02400000 08000000 00000201 40100100 38078600 32022020 0250001c 00100400 c0000000 00800000 90000081 08008300 00060001 80040000 00804200 |