On Target NOS1_HUMAN 0.29113925/CHEMBL4086610
For the given ligand Sulfasalazine, we have found in our database that, being scored 0.29113925, the most similar ligand is CHEMBL4086610. Check out the elaboration below.
| Sulfasalazine (Given Ligand) | CHEMBL4086610 (Similar Ligand) |
|---|---|
| O=C(O)c3cc(/N=N/c2ccc(S(=O)(=O)Nc1ccccn1)cc2)ccc3O | CNCc1cccc(OCc2ccc3c(C)cc(N)nc3c2)c1 |
|
|
|
|
|
|
| 00000012 00882808 61004102 00b10200 00050012 00024000 02000000 00000800 00000300 00040840 00002104 60008000 00048c02 08000001 80280050 102e200c 0000a000 02800000 00600000 80226001 c0000000 0e229a20 20840846 0860200c 00050480 c1000000 80040080 0400004c 00500408 20060000 c0000080 00010060 | 04000002 44000808 20004108 00010600 00041005 0000c000 02000000 02001000 00400100 00000840 00200004 40008000 80800802 00410080 01000041 020c000c 00000001 02000000 00280000 00220200 40000000 0c008028 20800800 80e49000 00040000 80002000 000000c0 80000000 00000308 00060000 40040000 00000220 |