On Target NK1R_HUMAN 0.34666666/CHEMBL119990
For the given ligand Methotrimeprazine, we have found in our database that, being scored 0.34666666, the most similar ligand is CHEMBL119990. Check out the elaboration below.
| Methotrimeprazine (Given Ligand) | CHEMBL119990 (Similar Ligand) |
|---|---|
| COc3ccc2sc1ccccc1n(C[C@H](C)CN(C)C)c2c3 | COc1ccccc1[C@H](C)C(=O)N2CC3[C@@H](C2)C(CC[S+]3[O-])(c4ccccc4)c5ccccc5 |
|
|
|
|
|
|
| 00000000 43000400 20100100 08110500 00080000 00002000 00000000 20000000 04200000 020241e0 00200000 400b8000 00010006 05840000 00000000 00080008 04a00000 00000000 02c02000 00000201 40000000 10000010 010003c0 04300010 00000001 00000000 00004000 10000000 00000200 00040030 00000000 03012200 | 00000000 43001208 2010010a 08510640 00001000 00000010 0a000000 29000200 04700880 020a48c0 08300000 600790c0 01118006 00240500 41000001 00042008 94001000 02000010 00002000 00020301 60000100 18a40610 00000300 85700018 0000c000 e0000418 00004000 50000000 04000380 0006c03b 00002000 03012600 |