On Target NK1R_HUMAN 0.5913978/CHEMBL1817821
For the given ligand Ketamine, we have found in our database that, being scored 0.5913978, the most similar ligand is CHEMBL1817821. Check out the elaboration below.
| Ketamine (Given Ligand) | CHEMBL1817821 (Similar Ligand) |
|---|---|
| CNC2(c1ccccc1Cl)CCCCC2=O | Cl.Clc1ccc(cc1)C(C2CN(Cc3ccccc3)CCC2=O)c4ccc(Cl)cc4 |
|
|
|
|
|
|
| 00018000 01000000 00100102 00010600 00000000 00000000 00000000 02001000 00200800 000808c0 08300000 4001b880 0700880c 00200000 40000000 00000000 80000000 02000000 02002000 00000001 00000d00 18008310 00000000 00500010 00002000 80000200 00000000 90000000 00000102 00060002 08066000 00020600 | 00008000 01000200 00100102 00010600 00000000 00000000 00000000 23001000 00000800 000808c0 08300000 50019800 0e008826 00200000 00000400 00040000 00000000 02000000 00002018 00000201 00000100 18008310 00000000 00500010 00003800 e0000000 00040000 d0000000 00000182 0006000a 20040000 00022600 |