On Target ALDR_HUMAN 0.34177214/CHEMBL51483
For the given ligand Mesalazine, we have found in our database that, being scored 0.34177214, the most similar ligand is CHEMBL51483. Check out the elaboration below.
| Mesalazine (Given Ligand) | CHEMBL51483 (Similar Ligand) |
|---|---|
| Nc1ccc(O)c(C(=O)O)c1 | CC(C)c1c(O)c(O)c(C=O)c2c(O)c(c(C)cc12)c3c(C)cc4c(C(C)C)c(O)c(O)c(C=O)c4c3O |
|
|
|
|
|
|
| 00000002 00000808 20000100 00010200 00000000 00024000 02000000 00000800 00000100 00000840 00000004 40008000 00008002 00000000 00000040 10082008 00000000 02000000 00000000 80020000 40000000 08020a20 20000000 00400004 00040000 80000000 00040000 00000000 00400000 00060000 c0000000 00000000 | 00002000 42000809 20000100 40010200 00000001 28020000 02000000 00000200 00000100 00080840 08000000 40008800 00008002 00200000 20000000 2000a008 00020000 02000000 04000000 10220a00 00000000 08020208 10000000 00404014 00000000 80000000 101a0000 00000040 00004000 00020002 80000200 00000400 |